CAS 102039-76-9

3-deoxy-3-fluorosucrose

Description:

3-Deoxy-3-fluorosucrose is a synthetic derivative of sucrose, characterized by the substitution of a fluorine atom at the 3-position of the sugar molecule. This modification alters its chemical properties and biological activity compared to its parent compound, sucrose. The presence of the fluorine atom can influence the molecule's reactivity, stability, and interaction with biological systems, potentially affecting its metabolism and physiological effects. As a sugar analog, 3-deoxy-3-fluorosucrose may exhibit unique properties in terms of sweetness, solubility, and potential applications in medicinal chemistry or as a research tool in carbohydrate chemistry. Its structural modifications may also impact its role in enzymatic reactions or its ability to serve as a substrate for various biological processes. Overall, 3-deoxy-3-fluorosucrose represents an interesting compound for further study in both synthetic and biological chemistry contexts.

Formula: C₁₂H₂₁FO₁₀

InChI: InChI=1/C12H21FO10/c13-6-7(17)4(1-14)21-11(9(6)19)23-12(3-16)10(20)8(18)5(2-15)22-12/h4-11,14-20H,1-3H2/t4-,5-,6+,7-,8-,9-,10+,11-,12+/m1/s1

Synonyms:

• alpha-D-Glucopyranoside, beta-D-fructofuranosyl 3-deoxy-3-fluoro-
• beta-D-fructofuranosyl 3-deoxy-3-fluoro-alpha-D-glucopyranoside

3-Deoxy-3-fluorosucrose

CAS: 102039-76-9

3-Deoxy-3-fluorosucrose is a noncompetitive inhibitor of leuconostoc mesenteroides glucosyltransferases. It inhibits the enzyme by binding to the active site and preventing the transfer of glucose from the sugar transport to the acceptor. 3-Deoxy-3-fluorosucrose has been shown to inhibit the synthesis of pro-inflammatory cytokines, such as TNF-α and IL1β, in vitro. This inhibition is thought to be due to its ability to inhibit sugar transport and thus prevent glycosylation reactions that are required for protein synthesis.

Formula: C₁₂H₂₁FO₁₀

Purity: Min. 95%

Molecular weight: 344.29 g/mol

Ref: 3D-FD77711