CAS 102039-76-9: 3-deoxy-3-fluorosucrose

Description:3-Deoxy-3-fluorosucrose is a synthetic derivative of sucrose, characterized by the substitution of a fluorine atom at the 3-position of the sugar molecule. This modification alters its chemical properties and biological activity compared to its parent compound, sucrose. The presence of the fluorine atom can influence the molecule's reactivity, stability, and interaction with biological systems, potentially affecting its metabolism and physiological effects. As a sugar analog, 3-deoxy-3-fluorosucrose may exhibit unique properties in terms of sweetness, solubility, and potential applications in medicinal chemistry or as a research tool in carbohydrate chemistry. Its structural modifications may also impact its role in enzymatic reactions or its ability to serve as a substrate for various biological processes. Overall, 3-deoxy-3-fluorosucrose represents an interesting compound for further study in both synthetic and biological chemistry contexts.

Formula:C₁₂H₂₁FO₁₀

InChI:InChI=1/C12H21FO10/c13-6-7(17)4(1-14)21-11(9(6)19)23-12(3-16)10(20)8(18)5(2-15)22-12/h4-11,14-20H,1-3H2/t4-,5-,6+,7-,8-,9-,10+,11-,12+/m1/s1