CAS 1020412-43-4
:4-Amino-2-[(ethylamino)methyl]-α,α-dimethyl-1H-imidazo[4,5-c]quinoline-1-ethanol
Description:
4-Amino-2-[(ethylamino)methyl]-α,α-dimethyl-1H-imidazo[4,5-c]quinoline-1-ethanol is a complex organic compound characterized by its imidazoquinoline structure, which incorporates both amino and ethanol functional groups. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl and amino groups, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, possibly as a pharmacological agent, given the presence of the imidazoquinoline moiety, which is often associated with various therapeutic effects. The compound may also display basic properties due to the amino groups, influencing its reactivity and interaction with other chemical species. Additionally, the presence of ethyl and dimethyl substituents can affect its lipophilicity and overall stability. As with many organic compounds, its behavior in biological systems and potential applications would require further investigation through experimental studies. Safety and handling precautions should be observed, as with any chemical substance, particularly in research or industrial settings.
Formula:C17H23N5O
InChI:InChI=1S/C17H23N5O/c1-4-19-9-13-21-14-15(22(13)10-17(2,3)23)11-7-5-6-8-12(11)20-16(14)18/h5-8,19,23H,4,9-10H2,1-3H3,(H2,18,20)
InChI key:InChIKey=FHJATBIERQTCTN-UHFFFAOYSA-N
SMILES:C(C(C)(C)O)N1C=2C=3C(N=C(N)C2N=C1CNCC)=CC=CC3
Synonyms:- 1-(4-Amino-2-ethylaminomethylimidazo-[4,5-c]quinolin-1-yl)-2-methylpropan-2-ol
- 4-Amino-2-[(ethylamino)methyl]-α,α-dimethyl-1H-imidazo[4,5-c]quinoline-1-ethanol
- Gardiquimod
- 1H-Imidazo[4,5-c]quinoline-1-ethanol, 4-amino-2-[(ethylamino)methyl]-α,α-dimethyl-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Gardiquimod
CAS:Gardiquimod, an imidazoquinoline TLR7 agonist, inhibits HIV-1 in macrophages and PBMCs under 10μM.Formula:C17H23N5OPurity:98.02% - 99.68%Color and Shape:SolidMolecular weight:313.3974Gardiquimod
CAS:1-(4-Amino-2-((ethylamino)methyl)-1H-imidazo[4,5-c]quinolin-1-yl)-2-methylpropan-2-olFormula:C17H23N5OPurity:97%Molecular weight:313.4Gardiquimod
CAS:Formula:C17H23N5OPurity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:313.4Gardiquimod
CAS:Gardiquimod is a synthetic imidazoquinoline, which is a small molecule produced through chemical synthesis. Its primary mode of action involves binding to Toll-like receptor 7 (TLR7), a pattern recognition receptor that plays a pivotal role in the innate immune response. Through this interaction, Gardiquimod activates antigen-presenting cells such as dendritic cells and macrophages, leading to the production of type I interferons and other inflammatory cytokines.Formula:C17H23N5OPurity:Min. 95%Molecular weight:313.4 g/mol





