CymitQuimica logo

CAS 10205-71-7

:

Benzenamine, 4-(6-methoxy-2-benzothiazolyl)-N,N-dimethyl-

Description:
Benzenamine, 4-(6-methoxy-2-benzothiazolyl)-N,N-dimethyl- is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a dimethylamino group and a benzothiazole moiety. The presence of the methoxy group enhances its solubility and reactivity. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in dye synthesis, pharmaceuticals, and as a chemical intermediate. Its molecular structure suggests it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, due to the electron-donating nature of the dimethylamino group. Additionally, the benzothiazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure, as aromatic amines can pose health risks. Overall, this compound exemplifies the complexity and utility of substituted aromatic amines in organic chemistry.
Formula:C16H16N2OS
InChI:InChI=1S/C16H16N2OS/c1-18(2)12-6-4-11(5-7-12)16-17-14-9-8-13(19-3)10-15(14)20-16/h4-10H,1-3H3
InChI key:POFIKJKJPDPHTI-UHFFFAOYSA-N
SMILES:CN(C)C1=CC=C(C=C1)C2=NC3=C(S2)C=C(C=C3)OC
Found 4 products.