CAS 102056-64-4
:3-(Triethoxysilyl)propyl cyclopentane
Description:
3-(Triethoxysilyl)propyl cyclopentane, identified by its CAS number 102056-64-4, is an organosilicon compound characterized by the presence of a triethoxysilyl group attached to a propyl chain, which is further connected to a cyclopentane ring. This compound typically exhibits properties associated with both organic and inorganic materials, making it useful in various applications, particularly in surface modification and adhesion. The triethoxysilyl group allows for the formation of siloxane bonds with substrates, enhancing adhesion to glass, metals, and ceramics. Its cyclopentane structure contributes to its hydrophobic characteristics, which can improve water resistance in coatings and sealants. Additionally, the presence of ethoxy groups provides potential for further chemical reactivity, enabling the incorporation of this compound into polymer matrices or as a coupling agent in composite materials. Overall, 3-(Triethoxysilyl)propyl cyclopentane is valued for its versatility in enhancing material properties and facilitating chemical bonding in various industrial applications.
Formula:C14H30O3Si
InChI:InChI=1/C14H30O3Si/c1-4-15-18(16-5-2,17-6-3)13-9-12-14-10-7-8-11-14/h14H,4-13H2,1-3H3
SMILES:CCO[Si](CCCC1CCCC1)(OCC)OCC
Synonyms:- (3-Cyclopentylpropyl)(Triethoxy)Silane
- (3-Cyclopentadienylpropyl)triethoxysilane-dimer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
