CAS 10206-02-7

2-(2-Pyridinyl)-1H-naphth[2,3-d]imidazole

Description:

2-(2-Pyridinyl)-1H-naphth[2,3-d]imidazole, with the CAS number 10206-02-7, is a heterocyclic compound characterized by its fused ring structure, which includes both naphthalene and imidazole moieties. This compound features a pyridine substituent, contributing to its aromaticity and potential for various chemical interactions. It typically exhibits properties such as moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic naphthalene component. The presence of nitrogen atoms in the imidazole and pyridine rings can impart basicity and influence its reactivity, making it a candidate for coordination with metal ions or participation in various organic reactions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is analyzed.

Formula: C₁₆H₁₁N₃

InChI: InChI=1S/C16H11N3/c1-2-6-12-10-15-14(9-11(12)5-1)18-16(19-15)13-7-3-4-8-17-13/h1-10H,(H,18,19)

InChI key: InChIKey=GJADDFHYLPUPBD-UHFFFAOYSA-N

SMILES: C1=2C(N=C(N1)C3=CC=CC=N3)=CC=4C(C2)=CC=CC4

Synonyms:

• 2-(2-Pyridinyl)-1H-naphth[2,3-d]imidazole
• 1H-Naphth[2,3-d]imidazole, 2-(2-pyridinyl)-
• 2-(2′-Pyridyl)naphth[2,3-d]imidazole
• Naphth[2,3-d]imidazole, 2-(2-pyridyl)-
• 1H-Naphth[2,3-d]imidazole, 2-(2-pyridyl)-

1H-Naphth[2,3-d]imidazole, 2-(2-pyridinyl)-

CAS: 10206-02-7

Formula: C₁₆H₁₁N₃

Molecular weight: 245.2786

Ref: IN-DA0006HU