CymitQuimica logo

CAS 102061-91-6

:

sodium 5-ethoxycarbonyl-2-methylsulfanyl-pyrimidin-4-olate

Description:
Sodium 5-ethoxycarbonyl-2-methylsulfanyl-pyrimidin-4-olate, with the CAS number 102061-91-6, is a chemical compound that belongs to the class of pyrimidine derivatives. It features a pyrimidine ring substituted with an ethoxycarbonyl group and a methylsulfanyl group, which contribute to its unique chemical properties. The presence of the sodium ion indicates that it is a salt, which can enhance its solubility in polar solvents, making it useful in various applications. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a research chemical. Its structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the ethoxycarbonyl group may influence its reactivity and stability, while the methylsulfanyl group could impart specific electronic properties. Overall, sodium 5-ethoxycarbonyl-2-methylsulfanyl-pyrimidin-4-olate is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C8H9N2NaO3S
InChI:InChI=1/C8H10N2O3S.Na/c1-3-13-7(12)5-4-9-8(14-2)10-6(5)11;/h4H,3H2,1-2H3,(H,9,10,11);/q;+1/p-1
SMILES:CCOC(=O)c1cnc(nc1O)SC.[Na]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.