
CAS 102065-90-7
:3-Azetidinamine, 1-(diphenylmethyl)-, hydrochloride (1:2)
Description:
3-Azetidinamine, 1-(diphenylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the diphenylmethyl group indicates that the compound has significant steric bulk, which can influence its reactivity and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential for pharmaceutical applications. This compound may exhibit properties such as basicity due to the amine functional group, and it could participate in various chemical reactions, including nucleophilic substitutions and acylations. Its specific applications and biological activity would depend on its interaction with biological systems, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C16H18N2·2ClH
InChI:InChI=1S/C16H18N2.2ClH/c17-15-11-18(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;;/h1-10,15-16H,11-12,17H2;2*1H
InChI key:InChIKey=QUKSFTRHZVIHCH-UHFFFAOYSA-N
SMILES:C(N1CC(N)C1)(C2=CC=CC=C2)C3=CC=CC=C3.Cl
Synonyms:- 3-Azetidinamine, 1-(diphenylmethyl)-, dihydrochloride
- 3-Azetidinamine, 1-(diphenylmethyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.