
CAS 102065-93-0
:8-Bromo-6-chloro-2H-1,4-benzoxazin-3(4H)-one
Description:
8-Bromo-6-chloro-2H-1,4-benzoxazin-3(4H)-one is a heterocyclic organic compound characterized by its complex structure, which includes a benzoxazine ring system. This compound features both bromine and chlorine substituents, contributing to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the bromine atom typically enhances the compound's electrophilic properties, while the chlorine atom can influence its solubility and stability. The benzoxazine moiety is known for its role in forming polymers and as a precursor in organic synthesis. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 102065-93-0, allows for easy identification and retrieval of information regarding its properties, safety data, and potential uses. Overall, 8-Bromo-6-chloro-2H-1,4-benzoxazin-3(4H)-one is a valuable compound in research and development, particularly in the synthesis of more complex organic molecules.
Formula:C8H5BrClNO2
InChI:InChI=1S/C8H5BrClNO2/c9-5-1-4(10)2-6-8(5)13-3-7(12)11-6/h1-2H,3H2,(H,11,12)
InChI key:InChIKey=FKEYYNXXVBRNRG-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(Cl)=C1)NC(=O)CO2
Synonyms:- 2H-1,4-Benzoxazin-3(4H)-one, 8-bromo-6-chloro-
- 8-Bromo-6-chloro-2H-1,4-benzoxazin-3(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.