
CAS 1020703-69-8
:3-(3-Fluoro-4-methoxyphenyl)-1-phenyl-1H-pyrazole-4-carboxaldehyde
Description:
3-(3-Fluoro-4-methoxyphenyl)-1-phenyl-1H-pyrazole-4-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a phenyl group, and an aldehyde functional group. The presence of a fluorine atom and a methoxy group on the aromatic ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is typically used in medicinal chemistry and may exhibit various pharmacological effects, making it of interest in drug development. Its molecular structure allows for potential interactions with biological targets, which can be explored in research settings. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions, making it essential to consider these factors in experimental applications. Additionally, the presence of the aldehyde group suggests that it may participate in condensation reactions or serve as a precursor for further chemical modifications. Overall, this compound represents a valuable entity in the field of organic synthesis and medicinal chemistry.
Formula:C17H13FN2O2
InChI:InChI=1S/C17H13FN2O2/c1-22-16-8-7-12(9-15(16)18)17-13(11-21)10-20(19-17)14-5-3-2-4-6-14/h2-11H,1H3
InChI key:InChIKey=OTOIIJRHXCTZNA-UHFFFAOYSA-N
SMILES:C(=O)C=1C(=NN(C1)C2=CC=CC=C2)C3=CC(F)=C(OC)C=C3
Synonyms:- 3-(3-Fluoro-4-methoxyphenyl)-1-phenyl-1H-pyrazole-4-carboxaldehyde
- 1H-Pyrazole-4-carboxaldehyde, 3-(3-fluoro-4-methoxyphenyl)-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3-Fluoro-4-methoxyphenyl)-1-phenylpyrazole-4-carbaldehyde
CAS:<p>3-(3-Fluoro-4-methoxyphenyl)-1-phenylpyrazole-4-carbaldehyde</p>Molecular weight:296.29572g/mol

