CAS 1020718-00-6: 1-(Chloromethyl)-2-fluoro-3-nitrobenzene

Description:1-(Chloromethyl)-2-fluoro-3-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloromethyl group, a fluorine atom, and a nitro group. The presence of these substituents influences its chemical reactivity and physical properties. The chloromethyl group typically enhances the compound's electrophilicity, making it a potential intermediate in various organic synthesis reactions. The fluorine atom can impart unique electronic properties, often increasing the compound's lipophilicity and stability. The nitro group is known for its strong electron-withdrawing effects, which can further modify the compound's reactivity. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals due to its functional groups. Additionally, its handling requires caution due to the potential toxicity associated with halogenated and nitro compounds. Overall, 1-(Chloromethyl)-2-fluoro-3-nitrobenzene is a versatile compound with significant implications in synthetic organic chemistry.

Formula:C₇H₅ClFNO₂

InChI:InChI=1S/C7H5ClFNO2/c8-4-5-2-1-3-6(7(5)9)10(11)12/h1-3H,4H2

InChI key:InChIKey=VSKUTYKGLMWRNW-UHFFFAOYSA-N

SMILES:O=N(=O)C1=CC=CC(=C1F)CCl

Synonyms:
2-Fluoro-3-nitrobenzyl chloride
Benzene, 1-(chloromethyl)-2-fluoro-3-nitro-
1-(Chloromethyl)-2-fluoro-3-nitrobenzene

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzene, 1-(chloromethyl)-2-fluoro-3-nitro- REF: IN-DA0006HVCAS: 1020718-00-6	98%	To inquire	Tue 04 Mar 25
2-Fluoro-3-nitrobenzyl chloride REF: 54-PC48749CAS: 1020718-00-6	97%	106.00 €~180.00 €	Tue 11 Mar 25
1-(Dhloromethyl)-2-fluoro-3-nitrobenzene REF: 10-F229798CAS: 1020718-00-6	95.0%	To inquire	Wed 12 Mar 25
2-Fluoro-3-nitrobenzyl chloride REF: 3D-FF63924CAS: 1020718-00-6	Min. 95%	- - -	Discontinued product