CymitQuimica logo

CAS 1020719-11-2

:

1,2,3,6-Tetrahydro-2,3′-bipyridine-2′,4′,5′,6′-d4

Description:
1,2,3,6-Tetrahydro-2,3′-bipyridine-2′,4′,5′,6′-d4 is a deuterated derivative of tetrahydrobipyridine, which is a bicyclic organic compound featuring two fused pyridine rings. The presence of deuterium atoms (d4) indicates that four hydrogen atoms in the molecule have been replaced with deuterium, a heavier isotope of hydrogen. This substitution can influence the compound's physical and chemical properties, such as its stability, reactivity, and spectroscopic characteristics. The compound is likely to exhibit properties typical of nitrogen-containing heterocycles, including potential basicity due to the nitrogen atoms in the pyridine rings. It may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. The deuterated form is often used in research, particularly in studies involving kinetics and mechanisms, as well as in NMR spectroscopy, where the presence of deuterium can provide clearer spectral data. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry contexts.
Formula:C10H8D4N2
InChI:InChI=1S/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h1-4,6,8,10,12H,5,7H2/i3D,4D,6D,8D
InChI key:InChIKey=SOPPBXUYQGUQHE-AJEVBKBKSA-N
SMILES:C=1(C(=C(C(=NC1[2H])[2H])[2H])[2H])C2CC=CCN2
Synonyms:
  • 1,2,3,6-Tetrahydro-2,3′-bipyridine-2′,4′,5′,6′-d4
  • 2,3′-Bipyridine-2′,4′,5′,6′-d4, 1,2,3,6-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.