CAS 1020719-22-5
:2,4-Dihydro-4-[4-[4-(4-methoxyphenyl)-1-piperazinyl]phenyl]-2-(1-methylpropyl-2,2,3,3,3-d5)-3H-1,2,4-triazol-3-one
Description:
2,4-Dihydro-4-[4-[4-(4-methoxyphenyl)-1-piperazinyl]phenyl]-2-(1-methylpropyl-2,2,3,3,3-d5)-3H-1,2,4-triazol-3-one is a synthetic organic compound characterized by its complex molecular structure, which includes a triazole ring, piperazine moiety, and a methoxyphenyl group. This compound is notable for its potential pharmacological applications, particularly in the field of medicinal chemistry, where it may exhibit properties such as anti-inflammatory or antipsychotic effects. The presence of deuterated methyl groups suggests that it may be used in studies requiring isotopic labeling, enhancing its utility in research. Its solubility, stability, and reactivity would depend on the specific functional groups and their interactions with solvents and biological systems. As with many synthetic compounds, safety and handling precautions are essential, and its biological activity would require thorough investigation through in vitro and in vivo studies to determine efficacy and toxicity profiles.
Formula:C23H24D5N5O2
InChI:InChI=1S/C23H29N5O2/c1-4-18(2)28-23(29)27(17-24-28)21-7-5-19(6-8-21)25-13-15-26(16-14-25)20-9-11-22(30-3)12-10-20/h5-12,17-18H,4,13-16H2,1-3H3/i1D3,4D2
InChI key:InChIKey=IVIVGYTUQVJVPF-SGEUAGPISA-N
SMILES:O=C1N(C=NN1C(C(C([2H])([2H])[2H])([2H])[2H])C)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(OC)C=C4
Synonyms:- 2,4-Dihydro-4-[4-[4-(4-methoxyphenyl)-1-piperazinyl]phenyl]-2-(1-methylpropyl-2,2,3,3,3-d5)-3H-1,2,4-triazol-3-one
- 3H-1,2,4-Triazol-3-one, 2,4-dihydro-4-[4-[4-(4-methoxyphenyl)-1-piperazinyl]phenyl]-2-(1-methylpropyl-2,2,3,3,3-d5)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-sec-Butyl-d5-4-{4-[4-(4-methyloxy-phenyl)-piperazin-1-yl]-phenyl}-2,4-dihydro-[1,2,4]-triazol-3-one
CAS:Controlled ProductApplications 2-sec-Butyl-d5-4-{4-[4-(4-methyloxy-phenyl)-piperazin-1-yl]-phenyl}-2,4-dihydro-[1,2,4]-triazol-3-one (cas# 1020719-22-5) is a compound useful in organic synthesis.
Formula:C232H5H24N5O2Color and Shape:NeatMolecular weight:412.543H-1,2,4-Triazol-3-one, 2,4-dihydro-4-[4-[4-(4-methoxyphenyl)-1-piperazinyl]phenyl]-2-(1-methylpropyl-2,2,3,3,3-d5)-
CAS:Formula:C23H24D5N5O2Color and Shape:SolidMolecular weight:412.5395

