CymitQuimica logo

CAS 1020719-25-8

:

1-(9H-Carbazol-4-yloxy)-3-[[2-[2-(methoxy-d3)phenoxy]ethyl]amino]-2-propanol

Description:
1-(9H-Carbazol-4-yloxy)-3-[[2-[2-(methoxy-d3)phenoxy]ethyl]amino]-2-propanol, identified by its CAS number 1020719-25-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a carbazole moiety and a propanolamine framework. This compound features a carbazole ring, known for its stability and electronic properties, which contributes to its potential applications in organic electronics and pharmaceuticals. The presence of the methoxy-d3 group indicates that it is a deuterated compound, which can be useful in studies involving isotopic labeling. The compound's structure suggests it may exhibit biological activity, possibly acting as a pharmacological agent or a research tool in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific functional groups present and the overall molecular conformation. As with many synthetic compounds, further characterization through techniques such as NMR, mass spectrometry, and chromatography would be essential to fully understand its properties and potential applications.
Formula:C24H23D3N2O4
InChI:InChI=1S/C24H26N2O4/c1-28-21-10-4-5-11-22(21)29-14-13-25-15-17(27)16-30-23-12-6-9-20-24(23)18-7-2-3-8-19(18)26-20/h2-12,17,25-27H,13-16H2,1H3/i1D3
InChI key:InChIKey=OGHNVEJMJSYVRP-FIBGUPNXSA-N
SMILES:O(CC(CNCCOC1=C(OC([2H])([2H])[2H])C=CC=C1)O)C2=C3C=4C(NC3=CC=C2)=CC=CC4
Synonyms:
  • 1-(9H-Carbazol-4-yloxy)-3-[[2-[2-(methoxy-d3)phenoxy]ethyl]amino]-2-propanol
  • 1-(9H-Carbazol-4-yloxy)-3-[2-[2-(trideuteriomethoxy)phenoxy]ethylamino]propan-2-ol
  • 2-Propanol, 1-(9H-carbazol-4-yloxy)-3-[[2-[2-(methoxy-d3)phenoxy]ethyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.