CymitQuimica logo

CAS 1020719-50-9

:

S-(2-Hydroxyethyl-1,1,2,2-d4) methanesulfonothioate

Description:
S-(2-Hydroxyethyl-1,1,2,2-d4) methanesulfonothioate, with the CAS number 1020719-50-9, is a chemical compound characterized by its sulfonothioate functional group, which features a sulfur atom bonded to a methanesulfonyl group and a hydroxyethyl moiety. The presence of deuterium (d4) indicates that the compound has been isotopically labeled, which can be useful in various analytical applications, including tracing and studying metabolic pathways. This compound is likely to be a colorless to pale yellow liquid, exhibiting moderate solubility in polar solvents due to the hydroxyethyl group. Its chemical structure suggests potential reactivity typical of sulfonothioates, including nucleophilic substitution reactions. Additionally, the hydroxyethyl group may impart some degree of hydrophilicity, influencing its behavior in biological systems. Safety data should be consulted for handling and storage, as sulfonothioates can exhibit toxicity and environmental persistence. Overall, this compound is of interest in both synthetic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C3H4D4O3S2
InChI:InChI=1S/C3H8O3S2/c1-8(5,6)7-3-2-4/h4H,2-3H2,1H3/i2D2,3D2
InChI key:InChIKey=AGPKHLPHPSLRED-RRVWJQJTSA-N
SMILES:S(S(C)(=O)=O)C(C(O)([2H])[2H])([2H])[2H]
Synonyms:
  • S-(2-Hydroxyethyl-1,1,2,2-d4) methanesulfonothioate
  • Methanesulfonothioic acid, S-(2-hydroxyethyl-1,1,2,2-d4) ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.