CAS 1020719-52-1
:5-(Hydroxymethyl)-1-(phenyl-2,3,4,5,6-d5)-2(1H)-pyridinone
Description:
5-(Hydroxymethyl)-1-(phenyl-2,3,4,5,6-d5)-2(1H)-pyridinone, with the CAS number 1020719-52-1, is a chemical compound characterized by its pyridinone structure, which features a hydroxymethyl group and a deuterated phenyl substituent. The presence of the hydroxymethyl group indicates that the compound can participate in hydrogen bonding, potentially influencing its solubility and reactivity. The deuterated phenyl ring, containing five deuterium atoms, suggests that this compound may be used in studies requiring isotopic labeling, such as in NMR spectroscopy or metabolic tracing. The pyridinone moiety is known for its biological activity, often exhibiting properties such as antimicrobial or anti-inflammatory effects. The compound's unique isotopic composition and functional groups may also affect its physical properties, including melting point, boiling point, and spectral characteristics. Overall, this compound is of interest in both synthetic chemistry and pharmacological research due to its structural features and potential applications.
Formula:C12H6D5NO2
InChI:InChI=1S/C12H11NO2/c14-9-10-6-7-12(15)13(8-10)11-4-2-1-3-5-11/h1-8,14H,9H2/i1D,2D,3D,4D,5D
InChI key:InChIKey=YLTGBKWRQSGNOI-RALIUCGRSA-N
SMILES:O=C1N(C=C(CO)C=C1)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H]
Synonyms:- 5-(Hydroxymethyl)-1-(phenyl-2,3,4,5,6-d5)-2(1H)-pyridinone
- 2(1H)-Pyridinone, 5-(hydroxymethyl)-1-(phenyl-2,3,4,5,6-d5)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.