CAS 1020719-63-4
:2-(Methyl-d3)propanethioamide-3,3,3-d3
Description:
2-(Methyl-d3)propanethioamide-3,3,3-d3 is a deuterated compound, which means it contains deuterium, a stable isotope of hydrogen. This specific compound features a thioamide functional group, characterized by the presence of a sulfur atom bonded to a carbonyl carbon and an amine group. The presence of deuterium in the methyl groups indicates that the hydrogen atoms in those positions have been replaced with deuterium, which can be useful in various applications, including NMR spectroscopy and metabolic studies. The molecular structure suggests that it is a derivative of propanethioamide, with additional methyl groups contributing to its overall properties. As a thioamide, it may exhibit characteristics typical of this functional group, such as potential reactivity in nucleophilic substitution reactions and the ability to form hydrogen bonds. The compound's unique isotopic labeling can also influence its physical and chemical properties, including solubility and stability, making it valuable in research and analytical chemistry.
Formula:C4H3D6NS
InChI:InChI=1S/C4H9NS/c1-3(2)4(5)6/h3H,1-2H3,(H2,5,6)/i1D3,2D3
InChI key:InChIKey=NPCLRBQYESMUPD-WFGJKAKNSA-N
SMILES:C(C(N)=S)(C([2H])([2H])[2H])C([2H])([2H])[2H]
Synonyms:- 2-(Methyl-d3)propanethioamide-3,3,3-d3
- Propanethioamide-3,3,3-d3, 2-(methyl-d3)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
