CAS 1020719-70-3
:5-(3-Pyridinyl-2,4,5,6-d<sub>4</sub>)-2-pyrrolidinone
Description:
5-(3-Pyridinyl-2,4,5,6-d4)-2-pyrrolidinone is a deuterated derivative of pyrrolidinone, characterized by the presence of a pyridine ring substituted at the 3-position with deuterated hydrogen atoms. This compound is notable for its potential applications in medicinal chemistry and drug development, particularly in studies involving metabolic pathways and pharmacokinetics, where deuteration can enhance the stability and bioavailability of the molecule. The presence of the pyridine moiety contributes to its aromatic properties, while the pyrrolidinone structure provides a cyclic amide functionality, which can participate in various chemical reactions. The deuteration not only alters the physical properties, such as boiling and melting points, but also affects the NMR spectroscopic characteristics, making it useful for analytical purposes. Overall, this compound exemplifies the intersection of organic chemistry and pharmaceutical research, highlighting the importance of isotopic labeling in understanding drug behavior in biological systems.
Formula:C9H6D4N2O
InChI:InChI=1S/C9H10N2O/c12-9-4-3-8(11-9)7-2-1-5-10-6-7/h1-2,5-6,8H,3-4H2,(H,11,12)/i1D,2D,5D,6D
InChI key:InChIKey=FXFANIORDKRCCA-NMRLXUNGSA-N
SMILES:O=C1NC(CC1)C=2C(=C(C(=NC2[2H])[2H])[2H])[2H]
Synonyms:- 2-Pyrrolidinone, 5-(3-pyridinyl-2,4,5,6-d4)-
- 5-(3-Pyridinyl-2,4,5,6-d4)-2-pyrrolidinone
- (R,S)-Norcotinine-13C3 solution
- (+/-)-DeMethylcotinine-d4
- (RS)-Norcotinine-d4
- 5-(3-Pyridinyl-2,4,5,6-d
- (R,S)-NORCOTININE-PYRIDYL-D4
- 4
- (+/-)-Norcotinine-d4
- 5-(3-PYRIDINYL)-2-PYRROLIDINONE-PYRIDYL-D4
- )-2-pyrrolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(R,S)-Norcotinine-pyridyl-d4
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications (R,S)-Norcotinine-pyridyl-d4 (cas# 1020719-70-3) is a compound useful in organic synthesis.<br></p>Formula:C92H4H6N2OColor and Shape:Off White SolidMolecular weight:166.21

