CAS 1020719-86-1
:4-Amino-N-(5-methyl-3-isoxazolyl)benzene-2,3,5,6-d4-sulfonamide
Description:
4-Amino-N-(5-methyl-3-isoxazolyl)benzene-2,3,5,6-d4-sulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the isoxazole ring contributes to its potential biological activity, as this heterocyclic structure is often found in various pharmaceuticals. The compound features a benzene ring substituted with an amino group and a sulfonamide moiety, which enhances its solubility and reactivity. The deuterated positions (2, 3, 5, and 6) indicate that hydrogen atoms in these locations are replaced with deuterium, which can be useful in studies involving metabolic pathways or pharmacokinetics. This modification can also affect the compound's physical properties, such as its mass and stability. Overall, the unique structural features of this compound suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C10H7D4N3O3S
InChI:InChI=1S/C10H11N3O3S/c1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9/h2-6H,11H2,1H3,(H,12,13)/i2D,3D,4D,5D
InChI key:InChIKey=JLKIGFTWXXRPMT-QFFDRWTDSA-N
SMILES:S(NC=1C=C(C)ON1)(=O)(=O)C2=C(C(=C(N)C(=C2[2H])[2H])[2H])[2H]
Synonyms:- Benzene-2,3,5,6-d4-sulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)-
- 4-Amino-N-(5-methyl-3-isoxazolyl)benzene-2,3,5,6-d4-sulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Sulfamethoxazole-d4
CAS:Formula:C10H7D4N3O3SColor and Shape:White To Off-White SolidMolecular weight:257.30Sulfamethoxazole-d4 (benzene--d4)
CAS:Purity:98 atom % DColor and Shape:White To Off White SolidMolecular weight:257.30Sulfamethoxazole-d4
CAS:Sulfamethoxazole-d4 (Ro4-2130 D4) is a deuterium labeled Sulfamethoxazole, isotope tracing. Sulfamethoxazole is a sulfonamide antimicrobial agent.Formula:C10H11N3O3SPurity:98%Color and Shape:SolidMolecular weight:257.3Sulfamethoxazole D4 (benzene D4)
CAS:Controlled ProductFormula:C10H4H7N3O3SColor and Shape:NeatMolecular weight:257.30Sulfamethoxazole D4 (benzene D4) 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:C10H4H7N3O3SColor and Shape:Single SolutionMolecular weight:257.30Sulfamethoxazole-d4
CAS:Controlled Product<p>Applications The isotopically labelled antibacterial drug Sulfamethoxazole (S699086). Sulfonamide antibiotic that blocks the synthesis of dihydrofolic acid by inhibiting the enzyme dihydropteroate synthase.<br>References Rudy, B.C., et al.: Anal. Profiles Drug Subs., 2, 467 (1973), Wormser, G.P., et al.: Drugs, 24, 459 (1982), Wharton, M., et al.: Ann. Intern. Med., 105, 37 (1986),<br></p>Formula:C102H4H7N3O3SColor and Shape:Light YellowMolecular weight:257.30Sulfamethoxazole-d4
CAS:<p>Sulfamethoxazole-d4 is a deuterated analog of sulfamethoxazole, which is a synthetic antibacterial agent. It is primarily sourced from chemical synthesis processes that involve replacing hydrogen atoms with deuterium in the sulfamethoxazole molecule. This isotope labeling provides a distinctive advantage in pharmacokinetic studies, as it allows for the precise tracking and differentiation of the deuterated form from the non-labeled drug in biological systems.</p>Formula:C10H11N3O3SPurity:Min. 95%Molecular weight:257.3 g/molSulfamethoxazole D4 (benzene D4)
CAS:Formula:C10H7D4N3O3SPurity:98%Color and Shape:SolidMolecular weight:257.3023






