CAS 1020719-86-1: 4-Amino-N-(5-methyl-3-isoxazolyl)benzene-2,3,5,6-d4-sulfonamide
Description:4-Amino-N-(5-methyl-3-isoxazolyl)benzene-2,3,5,6-d4-sulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the isoxazole ring contributes to its potential biological activity, as this heterocyclic structure is often found in various pharmaceuticals. The compound features a benzene ring substituted with an amino group and a sulfonamide moiety, which enhances its solubility and reactivity. The deuterated positions (2, 3, 5, and 6) indicate that hydrogen atoms in these locations are replaced with deuterium, which can be useful in studies involving metabolic pathways or pharmacokinetics. This modification can also affect the compound's physical properties, such as its mass and stability. Overall, the unique structural features of this compound suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C10H7D4N3O3S
InChI:InChI=1S/C10H11N3O3S/c1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9/h2-6H,11H2,1H3,(H,12,13)/i2D,3D,4D,5D
InChI key:InChIKey=JLKIGFTWXXRPMT-QFFDRWTDSA-N
SMILES:O=S(=O)(NC1=NOC(=C1)C)C2=CC=C(N)C=C2
- Synonyms:
- Benzene-2,3,5,6-d4-sulfonamide, 4-amino-N-(5-methyl-3-isoxazolyl)-
- 4-Amino-N-(5-methyl-3-isoxazolyl)benzene-2,3,5,6-d4-sulfonamide