
CAS 102072-85-5
:6,7-Dichloro-5,8-phthalazinedione
Description:
6,7-Dichloro-5,8-phthalazinedione, with the CAS number 102072-85-5, is a synthetic organic compound characterized by its unique structure, which includes a phthalazine core with two chlorine substituents at the 6 and 7 positions and carbonyl groups at the 5 and 8 positions. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. Its chemical properties include being relatively stable under standard conditions, but it may undergo reactions typical of carbonyl compounds, such as nucleophilic addition. The presence of chlorine atoms can influence its reactivity and solubility in organic solvents. Additionally, 6,7-Dichloro-5,8-phthalazinedione may exhibit biological activity, making it of interest for further research in medicinal chemistry. Safety data should be consulted to understand its handling and potential hazards, as halogenated compounds can pose environmental and health risks.
Formula:C8H2Cl2N2O2
InChI:InChI=1S/C8H2Cl2N2O2/c9-5-6(10)8(14)4-2-12-11-1-3(4)7(5)13/h1-2H
InChI key:InChIKey=UUBDFUMHESGMLX-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C(Cl)=C1Cl)=CN=NC2
Synonyms:- 6,7-Dichloro-5,8-phthalazinedione
- DA 3044
- 5,8-Phthalazinedione, 6,7-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.