CAS 1020722-18-2

5-Bromo-2-fluoro-4-(methylsulfonyl)benzenamine

Description:

5-Bromo-2-fluoro-4-(methylsulfonyl)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine atom, a fluorine atom, and a methylsulfonyl group attached to a benzene ring. The presence of the amino group (-NH2) indicates that it is an aniline derivative, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The bromine and fluorine substituents contribute to its reactivity and influence its physical properties, such as solubility and boiling point. The methylsulfonyl group enhances the compound's polarity and can affect its biological activity, making it of interest in pharmaceutical research. This compound may exhibit specific interactions with biological targets, potentially leading to applications in medicinal chemistry. Its synthesis typically involves halogenation and sulfonylation reactions, and it can be analyzed using techniques like NMR and mass spectrometry to confirm its structure and purity. Overall, 5-Bromo-2-fluoro-4-(methylsulfonyl)benzenamine is a versatile compound with potential applications in various fields, including drug development and materials science.

Formula: C₇H₇BrFNO₂S

InChI: InChI=1S/C7H7BrFNO2S/c1-13(11,12)7-3-5(9)6(10)2-4(7)8/h2-3H,10H2,1H3

InChI key: InChIKey=AUABVVTVFCCXIC-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=C(Br)C=C(N)C(F)=C1

Synonyms:

• 5-Bromo-2-fluoro-4-(methylsulfonyl)benzenamine
• Benzenamine, 5-bromo-2-fluoro-4-(methylsulfonyl)-