CymitQuimica logo

CAS 1020722-21-7

:

2-(1,1-Dimethylethyl)-7-(4-methyl-1-piperazinyl)-4-nitro-1H-indole

Description:
2-(1,1-Dimethylethyl)-7-(4-methyl-1-piperazinyl)-4-nitro-1H-indole, with the CAS number 1020722-21-7, is a chemical compound characterized by its complex structure, which includes an indole core substituted with a nitro group and a piperazine moiety. The presence of the 1,1-dimethylethyl group contributes to its hydrophobic characteristics, while the piperazine ring introduces basic properties due to the nitrogen atoms, which can participate in hydrogen bonding and enhance solubility in polar solvents. The nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. Its molecular interactions, stability under various conditions, and potential applications in medicinal chemistry are areas of ongoing investigation. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H24N4O2
InChI:InChI=1S/C17H24N4O2/c1-17(2,3)15-11-12-13(21(22)23)5-6-14(16(12)18-15)20-9-7-19(4)8-10-20/h5-6,11,18H,7-10H2,1-4H3
InChI key:InChIKey=BCHWSKUMCHMHDY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=C(C=C1)N3CCN(C)CC3)NC(C(C)(C)C)=C2
Synonyms:
  • 2-(1,1-Dimethylethyl)-7-(4-methyl-1-piperazinyl)-4-nitro-1H-indole
  • 1H-Indole, 2-(1,1-dimethylethyl)-7-(4-methyl-1-piperazinyl)-4-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.