CAS 1020722-33-1

4-Thiomorpholinepropanoic acid, methyl ester, 1-oxide

Description:

4-Thiomorpholinepropanoic acid, methyl ester, 1-oxide is a chemical compound characterized by its unique structure, which includes a thiomorpholine ring and a propanoic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, including potential solubility in polar solvents due to the presence of the ester and the thiomorpholine ring. The 1-oxide designation indicates the presence of an oxygen atom bonded to the nitrogen in the thiomorpholine, which can influence its reactivity and stability. Such compounds may exhibit biological activity, making them of interest in pharmaceutical research. The presence of the thiomorpholine structure can impart specific steric and electronic properties, affecting how the compound interacts with biological targets. Additionally, the methyl ester group can enhance lipophilicity, potentially influencing the compound's absorption and distribution in biological systems. Overall, 4-Thiomorpholinepropanoic acid, methyl ester, 1-oxide represents a class of compounds that may have diverse applications in medicinal chemistry and related fields.

Formula: C₈H₁₅NO₃S

InChI: InChI=1S/C8H15NO3S/c1-12-8(10)2-3-9-4-6-13(11)7-5-9/h2-7H2,1H3

InChI key: InChIKey=ARRXWWNHPMNRBG-UHFFFAOYSA-N

SMILES: C(CC(OC)=O)N1CCS(=O)CC1

Synonyms:

• 4-Thiomorpholinepropanoic acid, methyl ester, 1-oxide