CymitQuimica logo

CAS 1020722-62-6

:

4-Bromo-1-methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid

Description:
4-Bromo-1-methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a carboxylic acid functional group at the 5-position contributes to its reactivity and potential applications in various chemical reactions. The methyl and isobutyl substituents enhance its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure suggests potential for hydrogen bonding due to the carboxylic acid group, which can affect its physical properties, such as melting point and solubility in polar solvents. Overall, 4-Bromo-1-methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid is a versatile compound with significant implications in organic synthesis and medicinal chemistry.
Formula:C9H13BrN2O2
InChI:InChI=1S/C9H13BrN2O2/c1-5(2)4-6-7(10)8(9(13)14)12(3)11-6/h5H,4H2,1-3H3,(H,13,14)
InChI key:InChIKey=LNSXSLVRAARNQC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C(CC(C)C)=NN1C
Synonyms:
  • 1H-Pyrazole-5-carboxylic acid, 4-bromo-1-methyl-3-(2-methylpropyl)-
  • 4-Bromo-1-methyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.