CymitQuimica logo

CAS 1020722-66-0

:

4-Bromo-1-ethyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid

Description:
4-Bromo-1-ethyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a bromine atom at the 4-position and an ethyl group at the 1-position contributes to its unique reactivity and potential applications in organic synthesis. The 3-(2-methylpropyl) substituent adds steric bulk, influencing the compound's physical properties and interactions. As a carboxylic acid, it features a carboxyl functional group (-COOH), which imparts acidic characteristics and allows for potential participation in various chemical reactions, such as esterification or amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 4-Bromo-1-ethyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid represents a versatile structure in the realm of organic chemistry.
Formula:C10H15BrN2O2
InChI:InChI=1S/C10H15BrN2O2/c1-4-13-9(10(14)15)8(11)7(12-13)5-6(2)3/h6H,4-5H2,1-3H3,(H,14,15)
InChI key:InChIKey=PEIKPZBBHPNEPD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Br)C(CC(C)C)=NN1CC
Synonyms:
  • 4-Bromo-1-ethyl-3-(2-methylpropyl)-1H-pyrazole-5-carboxylic acid
  • 1H-Pyrazole-5-carboxylic acid, 4-bromo-1-ethyl-3-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.