CAS 102073-77-8

5,8-DIMETHOXY-1,2,3,4-TETRAHYDROISOQUINOLIN-4-OL HYDROCHLORIDE

Description:

5,8-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-4-ol hydrochloride is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a benzene ring fused to a pyridine ring. This specific compound contains two methoxy groups (-OCH3) at the 5 and 8 positions of the isoquinoline framework, contributing to its unique chemical properties and potential biological activities. The presence of a hydroxyl group (-OH) at the 4 position enhances its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceutical research. The compound may exhibit interesting pharmacological properties, including potential neuroprotective or psychoactive effects, which are often explored in medicinal chemistry. However, detailed studies on its biological activity and safety profile are essential for understanding its potential therapeutic uses.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1/C11H15NO3/c1-14-9-3-4-10(15-2)11-7(9)5-12-6-8(11)13/h3-4,8,12-13H,5-6H2,1-2H3

SMILES: COc1ccc(c2c1CNCC2O)OC

Synonyms:

• (4S)-4-hydroxy-5,8-dimethoxy-1,2,3,4-tetrahydroisoquinolinium
• (4R)-4-hydroxy-5,8-dimethoxy-1,2,3,4-tetrahydroisoquinolinium
• 5,8-Dimethoxy-1,2,3,4-Tetrahydroisoquinolin-4-Ol

5,8-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-4-ol

CAS: 102073-77-8

Formula: C₁₁H₁₅NO₃

Molecular weight: 209.2417

Ref: IN-DA0006L8

5,8-Dimethoxy-1,2,3,4-tetrahydroisoquinolin-4-ol

CAS: 102073-77-8

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO₃

Purity: Min. 95%

Molecular weight: 245.7 g/mol

Ref: 3D-CEA07377