CAS 102074-66-8

5-Methyl-1H-pyrrole-3-acetic acid

Description:

5-Methyl-1H-pyrrole-3-acetic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features a methyl group at the 5-position and an acetic acid functional group at the 3-position of the pyrrole ring. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the carboxylic acid group contributes to its acidity and potential reactivity, allowing it to participate in various chemical reactions, such as esterification or amidation. 5-Methyl-1H-pyrrole-3-acetic acid may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its solubility in polar solvents, such as water and alcohols, is notable, which can influence its applications in synthesis and formulation. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₇H₉NO₂

InChI: InChI=1S/C7H9NO2/c1-5-2-6(4-8-5)3-7(9)10/h2,4,8H,3H2,1H3,(H,9,10)

InChI key: InChIKey=CYDKEXZVCJCNEP-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=C(C)NC1

Synonyms:

• 2-(5-Methyl-1H-pyrrol-3-yl)acetic acid
• 1H-Pyrrole-3-acetic acid, 5-methyl-
• Pyrrole-3-acetic acid, 5-methyl-
• 5-Methyl-1H-pyrrole-3-acetic acid