CAS 1020999-77-2

N1,N1-Dimethyl-N3-(1-methylbutyl)-1,3-propanediamine

Description:

N1,N1-Dimethyl-N3-(1-methylbutyl)-1,3-propanediamine is an organic compound characterized by its structure, which includes two amine functional groups and a branched alkyl chain. This compound features a propanediamine backbone, with dimethyl substitutions at one nitrogen atom and a 1-methylbutyl group attached to the other nitrogen. The presence of these functional groups suggests that it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Its molecular structure indicates potential applications in various fields, including pharmaceuticals and agrochemicals, where amine compounds are often utilized for their reactivity and ability to interact with biological systems. Additionally, the branched alkyl chain may influence its solubility and volatility, impacting its behavior in different environments. Safety data and handling precautions should be considered, as with any chemical substance, due to the potential for toxicity associated with amines. Overall, N1,N1-Dimethyl-N3-(1-methylbutyl)-1,3-propanediamine represents a complex organic molecule with diverse chemical properties.

Formula: C₁₀H₂₄N₂

InChI: InChI=1S/C10H24N2/c1-5-7-10(2)11-8-6-9-12(3)4/h10-11H,5-9H2,1-4H3

InChI key: InChIKey=YEPKCHUUZJTENL-UHFFFAOYSA-N

SMILES: N(C(CCC)C)CCCN(C)C

Synonyms:

• 1,3-Propanediamine, N1,N1-dimethyl-N3-(1-methylbutyl)-
• N1,N1-Dimethyl-N3-(1-methylbutyl)-1,3-propanediamine