
CAS 1021124-74-2
:2,5-Difluoro-N-(2,2,2-trifluoroethyl)benzenamine
Description:
2,5-Difluoro-N-(2,2,2-trifluoroethyl)benzenamine is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with two fluorine atoms at the 2 and 5 positions, and a trifluoroethyl group attached to the nitrogen atom. This compound is notable for its fluorinated substituents, which can significantly influence its chemical properties, such as polarity, reactivity, and stability. The presence of fluorine atoms typically enhances the compound's lipophilicity and may impart unique biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the trifluoroethyl group can contribute to the compound's overall hydrophobic character. The compound's synthesis and handling require careful consideration due to the potential toxicity associated with fluorinated compounds. As with many fluorinated organic compounds, it may exhibit distinct solubility characteristics in various solvents, affecting its application in different chemical processes. Overall, 2,5-Difluoro-N-(2,2,2-trifluoroethyl)benzenamine represents a specialized class of fluorinated compounds with potential utility in various fields.
Formula:C8H6F5N
InChI:InChI=1S/C8H6F5N/c9-5-1-2-6(10)7(3-5)14-4-8(11,12)13/h1-3,14H,4H2
InChI key:InChIKey=AIDAREWGFCBDDC-UHFFFAOYSA-N
SMILES:N(CC(F)(F)F)C1=C(F)C=CC(F)=C1
Synonyms:- Benzenamine, 2,5-difluoro-N-(2,2,2-trifluoroethyl)-
- 2,5-Difluoro-N-(2,2,2-trifluoroethyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.