CAS 102115-83-3
:2-(Bromomethyl)spiro[3.3]heptane
Description:
2-(Bromomethyl)spiro[3.3]heptane is a chemical compound characterized by its unique spirocyclic structure, which consists of two fused cycloheptane rings sharing a single carbon atom. This compound features a bromomethyl group (-CH2Br) attached to one of the carbon atoms in the spiro framework, which can influence its reactivity and potential applications in organic synthesis. The presence of the bromine atom makes it a useful intermediate for further chemical transformations, such as nucleophilic substitutions or coupling reactions. The spiro structure contributes to its rigidity and can affect its physical properties, such as boiling point and solubility. Additionally, the compound may exhibit interesting stereochemical properties due to the spatial arrangement of its substituents. As with many brominated compounds, it is important to handle 2-(Bromomethyl)spiro[3.3]heptane with care, as bromine can be hazardous. Overall, this compound is of interest in the field of organic chemistry for its potential utility in synthesizing more complex molecules.
Formula:C8H13Br
InChI:InChI=1S/C8H13Br/c9-6-7-4-8(5-7)2-1-3-8/h7H,1-6H2
InChI key:InChIKey=LCYMYIXSODNRML-UHFFFAOYSA-N
SMILES:C(Br)C1CC2(C1)CCC2
Synonyms:- Spiro[3.3]heptane, 2-(bromomethyl)-
- 2-(Bromomethyl)spiro[3.3]heptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.