CAS 102117-40-8

Bis(trifluoromethylthio)benzoic acid

Description:

Bis(trifluoromethylthio)benzoic acid, with the CAS number 102117-40-8, is an organic compound characterized by the presence of two trifluoromethylthio groups attached to a benzoic acid structure. This compound features a benzoic acid moiety, which includes a carboxylic acid functional group (-COOH) that contributes to its acidic properties. The trifluoromethylthio groups (-SCF3) enhance the compound's lipophilicity and can influence its reactivity and stability. Typically, such compounds exhibit high thermal stability and may possess unique electronic properties due to the electronegative fluorine atoms. The presence of multiple trifluoromethylthio substituents can also lead to increased resistance to hydrolysis and other chemical reactions. Bis(trifluoromethylthio)benzoic acid is of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in synthesizing novel compounds and its role as a building block in organic synthesis. Its specific interactions and behavior in different environments can be further explored through experimental studies.

Formula: C₉H₄F₆O₂S₂

InChI: InChI=1/C9H4F6O2S2/c10-8(11,12)18-5-1-4(7(16)17)2-6(3-5)19-9(13,14)15/h1-3H,(H,16,17)

SMILES: c1c(cc(cc1SC(F)(F)F)SC(F)(F)F)C(=O)O

Synonyms:

• 3,5-Bis(trifluoromethylthio)benzoic acid
• 3,5-Bis[(Trifluoromethyl)Sulfanyl]Benzoic Acid

3,5-bis[(trifluoromethyl)sulfanyl]benzoic acid

CAS: 102117-40-8

Formula: C₉H₄F₆O₂S₂

Molecular weight: 322.2473

Ref: IN-DA0006NS

3,5-Bis[(trifluoromethyl)sulfanyl]benzoic acid

CAS: 102117-40-8

Purity: 98%

Molecular weight: 322.2399902

Ref: 10-F658496