CymitQuimica logo

CAS 1021188-26-0

:

(6E,8Z)-18-Hydroxy-5-oxo-6,8-octadecadienoic acid

Description:
(6E,8Z)-18-Hydroxy-5-oxo-6,8-octadecadienoic acid is a fatty acid derivative characterized by its unique double bond configuration and hydroxyl group. This compound features a long carbon chain typical of fatty acids, with specific geometric isomerism indicated by the (6E,8Z) notation, which refers to the positions and orientations of the double bonds in the carbon chain. The presence of a hydroxyl group at the 18th carbon contributes to its potential reactivity and solubility properties, making it more polar than typical fatty acids. The 5-oxo group indicates the presence of a ketone functional group, which can influence the compound's biological activity and interactions. This substance may be involved in various biochemical pathways, potentially serving as a signaling molecule or a precursor in lipid metabolism. Its specific structural features suggest potential applications in fields such as biochemistry, pharmacology, and nutrition, although detailed studies would be necessary to fully elucidate its biological roles and potential therapeutic uses.
Formula:C18H30O4
InChI:InChI=1S/C18H30O4/c19-16-11-9-7-5-3-1-2-4-6-8-10-13-17(20)14-12-15-18(21)22/h6,8,10,13,19H,1-5,7,9,11-12,14-16H2,(H,21,22)/b8-6-,13-10+
InChI key:InChIKey=WUMXVBSMANMBJK-WLPHGBIISA-N
SMILES:C(\C(CCCC(O)=O)=O)=C/C=C\CCCCCCCCCO
Synonyms:
  • 6,8-Octadecadienoic acid, 18-hydroxy-5-oxo-, (6E,8Z)-
  • (6E,8Z)-18-Hydroxy-5-oxo-6,8-octadecadienoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.