CAS 10212-20-1: 4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one
Description:4-Amino-1-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one, with CAS number 10212-20-1, is a chemical compound characterized by its pyrimidine and sugar moiety structure. This compound features an amino group at the 4-position of the pyrimidine ring, which contributes to its potential biological activity. The presence of a fluorine atom and hydroxyl groups on the sugar moiety enhances its solubility and reactivity, making it of interest in medicinal chemistry, particularly in the development of antiviral or anticancer agents. The stereochemistry indicated by the (2R,3R,4R,5R) configuration suggests specific spatial arrangements that can influence the compound's interactions with biological targets. Additionally, the hydroxymethyl group may play a role in hydrogen bonding, further affecting its pharmacological properties. Overall, this compound exemplifies the complexity and diversity of chemical structures that can be explored for therapeutic applications.
Formula:C9H12FN3O4
InChI:InChI=1S/C9H12FN3O4/c10-6-7(15)4(3-14)17-8(6)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16)/t4-,6-,7-,8-/m1/s1
InChI key:InChIKey=NVZFZMCNALTPBY-XVFCMESISA-N
SMILES:O=C1N=C(N)C=CN1C2OC(CO)C(O)C2F
- Synonyms:
- 2'-Deoxy-2'-Fluorocytidine
- 2'-Deoxy-2'-fluoro-D-cytidine
- 2'-Fc
- 2'-Fluoro-2'-Deoxycytidine
- 2'-Fluoro-D-Cytidine
- 2′-Fluoro-2′-deoxy-β-<span class="text-smallcaps">D</span>-ribofuranosylcytosine
- 4-Amino-1-((2R,3R,4R,5R)-3-Fluoro-4-Hydroxy-5-Hydroxymethyl-Tetrahydro-Furan-2-Yl)-1H-Pyrimidin-2-One
- 4-Amino-1-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one
- 4-amino-1-(2-deoxy-2-fluoropentofuranosyl)pyrimidin-2(1H)-one
- Cytidine, 2′-deoxy-2′-fluoro-
- See more synonyms
- NSC 529432