
CAS 10212-58-5
:2-Methyl-N-octadecyl-1-aziridinecarboxamide
Description:
2-Methyl-N-octadecyl-1-aziridinecarboxamide, with the CAS number 10212-58-5, is a chemical compound characterized by its aziridine ring structure, which contributes to its reactivity and potential applications in various fields. This compound features a long hydrophobic octadecyl chain, enhancing its lipophilicity and making it suitable for use in formulations that require compatibility with lipid environments. The presence of the methyl group at the second position of the aziridine ring can influence its steric properties and reactivity. As an amide, it exhibits characteristics typical of amides, such as potential hydrogen bonding capabilities, which can affect its solubility and interaction with other molecules. This compound may find applications in areas such as surfactants, emulsifiers, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential reactivity associated with aziridine derivatives. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C22H44N2O
InChI:InChI=1S/C22H44N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-22(25)24-20-21(24)2/h21H,3-20H2,1-2H3,(H,23,25)
InChI key:InChIKey=ZWCLYJFNWMDODI-UHFFFAOYSA-N
SMILES:C(NCCCCCCCCCCCCCCCCCC)(=O)N1C(C)C1
Synonyms:- Octadecylpropylene urea
- 1-Aziridinecarboxamide, 2-methyl-N-octadecyl-
- 2-Methyl-N-octadecyl-1-aziridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
