
CAS 1021245-77-1
:3-(3-Furanyl)-5-isoxazolamine
Description:
3-(3-Furanyl)-5-isoxazolamine is a chemical compound characterized by its unique structural features, which include a furanyl group and an isoxazolamine moiety. The furanyl group, derived from furan, contributes to the compound's aromatic properties and potential reactivity, while the isoxazolamine part introduces nitrogen into the heterocyclic structure, which can influence its biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the presence of both nitrogen and oxygen heteroatoms in the structure may enhance solubility and bioavailability. The compound's stability, reactivity, and potential toxicity would depend on its specific functional groups and the overall molecular configuration. As with many heterocyclic compounds, the synthesis and characterization of 3-(3-Furanyl)-5-isoxazolamine would involve techniques such as NMR spectroscopy, mass spectrometry, and possibly X-ray crystallography to confirm its structure and purity.
Formula:C7H6N2O2
InChI:InChI=1S/C7H6N2O2/c8-7-3-6(9-11-7)5-1-2-10-4-5/h1-4H,8H2
InChI key:InChIKey=RXOUNOPGLKFTNV-UHFFFAOYSA-N
SMILES:NC1=CC(=NO1)C=2C=COC2
Synonyms:- 5-Isoxazolamine, 3-(3-furanyl)-
- 3-(3-Furanyl)-5-isoxazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.