CymitQuimica logo

CAS 102126-71-6

:

1(3H)-Isobenzofuranone, 5-bromo-3-hydroxy-

Description:
1(3H)-Isobenzofuranone, 5-bromo-3-hydroxy- is an organic compound characterized by its unique bicyclic structure, which includes a fused isobenzofuranone moiety. This compound features a bromine atom at the 5-position and a hydroxyl group at the 3-position, contributing to its reactivity and potential applications in various chemical reactions. The presence of the bromine atom enhances its electrophilic character, making it suitable for substitution reactions. The hydroxyl group introduces polarity, which can influence solubility and interaction with biological systems. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential derivatization, which can lead to the synthesis of various analogs with modified properties. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential, particularly in the context of its use in research and industry. Overall, 1(3H)-Isobenzofuranone, 5-bromo-3-hydroxy- represents a versatile scaffold in organic synthesis and pharmaceutical development.
Formula:C8H5BrO3
InChI:InChI=1S/C8H5BrO3/c9-4-1-2-5-6(3-4)8(11)12-7(5)10/h1-3,8,11H
InChI key:HJPAMEIHXKSDRO-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1Br)C(OC2=O)O
Found 4 products.