CAS 102130-57-4
:Methyl 11-hydroxy-11-(3-pentyl-2-oxiranyl)-9-undecenoate
Description:
Methyl 11-hydroxy-11-(3-pentyl-2-oxiranyl)-9-undecenoate, with the CAS number 102130-57-4, is a chemical compound characterized by its unique structure that includes a long undecenoate chain, a hydroxyl group, and an epoxide moiety. This compound is likely to exhibit properties typical of esters, such as being relatively non-polar and having moderate solubility in organic solvents. The presence of the hydroxyl group suggests potential for hydrogen bonding, which may influence its reactivity and solubility in polar solvents. The epoxide group can participate in various chemical reactions, including ring-opening reactions, making it a versatile intermediate in organic synthesis. Additionally, the pentyl group contributes to the hydrophobic character of the molecule, which may affect its biological activity and interactions with other substances. Overall, this compound's structural features suggest it may have applications in fields such as pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.
Formula:C19H34O4
InChI:InChI=1S/C19H34O4/c1-3-4-10-14-17-19(23-17)16(20)13-11-8-6-5-7-9-12-15-18(21)22-2/h11,13,16-17,19-20H,3-10,12,14-15H2,1-2H3
InChI key:InChIKey=KUCGUAVQKWTIDU-UHFFFAOYSA-N
SMILES:C(CCCC)C1C(C(C=CCCCCCCCC(OC)=O)O)O1
Synonyms:- Methyl 12,13-epoxy-11-hydroxy-9-octadecenoate
- 9-Undecenoic acid, 11-hydroxy-11-(3-pentyloxiranyl)-, methyl ester
- Methyl 11-hydroxy-11-(3-pentyl-2-oxiranyl)-9-undecenoate
- 9-Undecenoic acid, 11-hydroxy-11-(3-pentyl-2-oxiranyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.