CAS 1021339-24-1

2-Chloro-4-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid

Description:

2-Chloro-4-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring, which is substituted at specific positions with a chloro group and an amino acid moiety. The presence of the chloro group introduces a halogen, which can influence the compound's reactivity and biological activity. The amino group, linked to a dimethyl-substituted propanoyl moiety, suggests potential for interactions in biological systems, possibly acting as a ligand or influencing enzyme activity. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form salts or esters. Its structure indicates potential applications in pharmaceuticals or agrochemicals, where modifications to the pyridine ring can enhance efficacy or selectivity. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions or acylation. Overall, the unique structural features of this compound contribute to its potential utility in various chemical and biological contexts.

Formula: C₁₁H₁₃ClN₂O₃

InChI: InChI=1S/C11H13ClN2O3/c1-11(2,3)10(17)14-6-4-5-13-8(12)7(6)9(15)16/h4-5H,1-3H3,(H,15,16)(H,13,14,17)

InChI key: InChIKey=FOGOGWIZSINXEC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(NC(C(C)(C)C)=O)=CC=NC1Cl

Synonyms:

• 2-Chloro-4-[(2,2-dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 2-chloro-4-[(2,2-dimethyl-1-oxopropyl)amino]-

2-Chloro-4-pivalamidonicotinic acid

CAS: 1021339-24-1

Formula: C₁₁H₁₃ClN₂O₃

Molecular weight: 256.6855

Ref: IN-DA008SDA