CAS 1021339-32-1: 4-Chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-3-pyridinecarboxylic acid

Description:4-Chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a chloro group and an amino acid moiety. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective characteristics, often utilized in organic synthesis to shield reactive functional groups. This compound is likely to exhibit polar characteristics due to the carboxylic acid and amino functionalities, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The chloro substituent may enhance its reactivity and influence its interaction with biological targets. Additionally, the compound's solubility and stability in various solvents can vary, impacting its usability in different chemical environments. Overall, this compound represents a versatile building block in medicinal chemistry, with potential implications in drug design and synthesis.

Formula:C₁₁H₁₃ClN₂O₄

InChI:InChI=1S/C11H13ClN2O4/c1-11(2,3)18-10(17)14-8-7(9(15)16)6(12)4-5-13-8/h4-5H,1-3H3,(H,15,16)(H,13,14,17)

InChI key:InChIKey=PMEJHBACZUJEML-UHFFFAOYSA-N

SMILES:O=C(O)C1=C(Cl)C=CN=C1NC(=O)OC(C)(C)C

Synonyms:
4-Chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-3-pyridinecarboxylic acid
3-Pyridinecarboxylic acid, 4-chloro-2-[[(1,1-dimethylethoxy)carbonyl]amino]-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-(TERT-BUTOXYCARBONYLAMINO)-4-CHLORONICOTINIC ACID REF: IN-DA008SD4CAS: 1021339-32-1	- - -	To inquire	Mon 03 Mar 25
2-((Tert-butoxycarbonyl)amino)-4-chloronicotinic acid REF: 10-F754889CAS: 1021339-32-1	95+%	- - -	Discontinued product
2-(tert-Butoxycarbonylamino)-4-chloronicotinic acid REF: 3D-WQB33932CAS: 1021339-32-1	Min. 95%	- - -	Discontinued product