
CAS 1021342-97-1
:1-(1,1-Dimethylethyl) 2-borono-5-(1-piperidinylcarbonyl)-1H-indole-1-carboxylate
Description:
1-(1,1-Dimethylethyl) 2-borono-5-(1-piperidinylcarbonyl)-1H-indole-1-carboxylate, with the CAS number 1021342-97-1, is a chemical compound that features a complex structure incorporating an indole moiety, a boron functional group, and a piperidine-derived carbonyl. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features that may interact with biological targets. The presence of the boron atom suggests potential reactivity and the ability to form coordination complexes, which can be advantageous in drug design. Additionally, the indole structure is known for its biological significance, often found in various natural products and pharmaceuticals. The piperidine ring contributes to the compound's lipophilicity and may enhance its ability to cross biological membranes. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural diversity in the development of new therapeutic agents.
Formula:C19H25BN2O5
InChI:InChI=1S/C19H25BN2O5/c1-19(2,3)27-18(24)22-15-8-7-13(11-14(15)12-16(22)20(25)26)17(23)21-9-5-4-6-10-21/h7-8,11-12,25-26H,4-6,9-10H2,1-3H3
InChI key:InChIKey=SGVLBCSJEPDDRZ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C=C1B(O)O)=CC(C(=O)N3CCCCC3)=CC2
Synonyms:- 1H-Indole-1-carboxylic acid, 2-borono-5-(1-piperidinylcarbonyl)-, 1-(1,1-dimethylethyl) ester
- 1-(1,1-Dimethylethyl) 2-borono-5-(1-piperidinylcarbonyl)-1H-indole-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Indole-1-carboxylic acid, 2-borono-5-(1-piperidinylcarbonyl)-, 1-(1,1-dimethylethyl) ester
CAS:Formula:C19H25BN2O5Molecular weight:372.2232
