
CAS 102139-27-5
:4-[1-(4-Hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxyphenol
Description:
4-[1-(4-Hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxyphenol, also known by its CAS number 102139-27-5, is an organic compound characterized by its complex aromatic structure. This substance features a phenolic core with multiple methoxy groups and a hydroxy substituent, contributing to its potential biological activity. The presence of the ethyl group linked to a hydroxy-substituted phenyl ring suggests that it may exhibit antioxidant properties, which are often associated with phenolic compounds. Its methoxy groups can enhance lipophilicity, potentially influencing its solubility and bioavailability. The compound may be of interest in pharmaceutical research, particularly in the context of developing therapeutic agents due to its structural features that could interact with biological targets. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, this compound represents a class of phenolic derivatives that may have significant implications in medicinal chemistry and related fields.
Formula:C17H20O5
InChI:InChI=1S/C17H20O5/c1-10(11-5-6-13(18)14(7-11)20-2)12-8-15(21-3)17(19)16(9-12)22-4/h5-10,18-19H,1-4H3
InChI key:InChIKey=BWXUQUPHOALVFU-UHFFFAOYSA-N
SMILES:C(C)(C1=CC(OC)=C(O)C(OC)=C1)C2=CC(OC)=C(O)C=C2
Synonyms:- 4-[1-(4-Hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxyphenol
- Phenol, 4-[1-(4-hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenol, 4-[1-(4-hydroxy-3-methoxyphenyl)ethyl]-2,6-dimethoxy-
CAS:Formula:C17H20O5Molecular weight:304.3377
