CAS 10214-27-4
:3-Methylbutyl 10-undecenoate
Description:
3-Methylbutyl 10-undecenoate, with the CAS number 10214-27-4, is an ester formed from the reaction of 3-methylbutanol and undecenoic acid. This compound typically appears as a colorless to pale yellow liquid with a characteristic fruity odor, making it of interest in the flavor and fragrance industries. It is known for its relatively low volatility and moderate solubility in organic solvents, while being less soluble in water. The presence of a double bond in its structure contributes to its reactivity, particularly in addition reactions. Additionally, 3-Methylbutyl 10-undecenoate may exhibit properties such as low toxicity and biodegradability, which are advantageous for various applications. Its chemical structure allows it to participate in polymerization processes, potentially leading to the development of new materials. As with many esters, it may also be used as a plasticizer or in the synthesis of other chemical compounds. Proper handling and storage are essential to maintain its stability and prevent degradation.
Formula:C16H30O2
InChI:InChI=1S/C16H30O2/c1-4-5-6-7-8-9-10-11-12-16(17)18-14-13-15(2)3/h4,15H,1,5-14H2,2-3H3
InChI key:InChIKey=DMSGZRWAESVGIP-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCCC=C)=O)CCC(C)C
Synonyms:- 3-Methylbutyl 10-undecenoate
- 10-Undecenoic acid, 3-methylbutyl ester
- Isopentyl undec-10-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
