CAS 102148-91-4

<span class="text-smallcaps">L</smallcap>-γ-Glutamyl-S-methyl-<smallcap>L</span>-cysteinyl-β-alanine

Description:

L-γ-Glutamyl-S-methyl-L-cysteinyl-β-alanine, with the CAS number 102148-91-4, is a peptide-like compound characterized by its unique structure that includes a γ-glutamyl group, a methylated cysteine, and β-alanine. This compound is notable for its potential biological activities, particularly in the context of antioxidant properties and cellular signaling. It may play a role in various biochemical pathways, including those related to cellular stress responses. The presence of the γ-glutamyl moiety suggests that it could be involved in the synthesis of glutathione or related compounds, which are crucial for maintaining redox balance in cells. Additionally, the methylation of the cysteine residue may influence its reactivity and interactions with other biomolecules. Overall, L-γ-Glutamyl-S-methyl-L-cysteinyl-β-alanine represents a fascinating area of study within peptide chemistry and biochemistry, with implications for understanding its role in health and disease.

Formula: C₁₂H₂₁N₃O₆S

InChI: InChI=1S/C12H21N3O6S/c1-22-6-8(11(19)14-5-4-10(17)18)15-9(16)3-2-7(13)12(20)21/h7-8H,2-6,13H2,1H3,(H,14,19)(H,15,16)(H,17,18)(H,20,21)/t7-,8-/m0/s1

InChI key: InChIKey=MSEXKIKRSMQHDG-YUMQZZPRSA-N

SMILES: [C@@H](NC(CC[C@@H](C(O)=O)N)=O)(C(NCCC(O)=O)=O)CSC

Synonyms:

• L-γ-Glutamyl-S-methyl-L-cysteinyl-β-alanine
• β-Alanine, L-γ-glutamyl-S-methyl-L-cysteinyl-
• β-Alanine, N-(N-L-γ-glutamyl-S-methyl-L-cysteinyl)-

L-γ-Glutamyl-S-methyl-L-cysteinyl-β-alanine

Controlled Product

CAS: 102148-91-4

Formula: C₁₂H₂₁N₃O₆S

Color and Shape: Neat

Molecular weight: 335.377

Ref: TR-G102140