CymitQuimica logo

CAS 102153-49-1

:

7-Bromo-1-nitronaphthalene

Description:
7-Bromo-1-nitronaphthalene is an organic compound characterized by the presence of both bromine and nitro functional groups attached to a naphthalene ring system. It features a bromine atom at the 7-position and a nitro group at the 1-position of the naphthalene structure, which contributes to its reactivity and potential applications in organic synthesis. This compound is typically a solid at room temperature and may exhibit a yellow to brown color, depending on its purity and specific conditions. It is known for its use in various chemical reactions, including electrophilic substitution and as an intermediate in the synthesis of more complex organic molecules. The presence of the bromine atom enhances its electrophilic character, while the nitro group can influence its electronic properties, making it a valuable compound in the field of materials science and pharmaceuticals. As with many halogenated compounds, it is important to handle 7-bromo-1-nitronaphthalene with care due to potential toxicity and environmental concerns.
Formula:C10H6BrNO2
InChI:InChI=1S/C10H6BrNO2/c11-8-5-4-7-2-1-3-10(12(13)14)9(7)6-8/h1-6H
InChI key:InChIKey=BGPCNRRMNRNIFR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C=CC(Br)=C2)C=CC1
Synonyms:
  • Naphthalene, 7-bromo-1-nitro-
  • 7-Bromo-1-nitronaphthalene
  • 2-Bromo-8-nitronaphthalene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.