CAS 102153-64-0
:7-Chloro-2-naphthalenesulfonyl chloride
Description:
7-Chloro-2-naphthalenesulfonyl chloride, with the CAS number 102153-64-0, is an organic compound characterized by the presence of a naphthalene ring substituted with a chlorine atom and a sulfonyl chloride group. This compound typically appears as a solid, often in a crystalline form, and is known for its reactivity due to the sulfonyl chloride functional group, which can undergo nucleophilic substitution reactions. It is commonly used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The chlorine atom at the 7-position of the naphthalene ring enhances its electrophilic character, making it a valuable intermediate in various chemical transformations. Additionally, this compound is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper safety precautions, including the use of personal protective equipment, are essential when working with this substance due to its potential irritant properties.
Formula:C10H6Cl2O2S
InChI:InChI=1S/C10H6Cl2O2S/c11-9-3-1-7-2-4-10(15(12,13)14)6-8(7)5-9/h1-6H
InChI key:InChIKey=XZHQZGPVPIOPFH-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC2=C(C=C1)C=CC(Cl)=C2
Synonyms:- 7-Chloronaphthalene-2-sulfonyl chloride
- 7-Chloro-2-naphthalenesulfonyl chloride
- 2-Naphthalenesulfonyl chloride, 7-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
