CAS 102153-71-9
:2-IODO-3-NITRONAPHTHALENE
Description:
2-Iodo-3-nitronaphthalene is an organic compound characterized by the presence of both iodine and nitro functional groups attached to a naphthalene ring system. It features a naphthalene backbone, which consists of two fused benzene rings, providing a stable aromatic structure. The iodine atom is located at the second position, while the nitro group is situated at the third position of the naphthalene framework. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration. It is known for its reactivity, particularly in electrophilic substitution reactions due to the electron-withdrawing nature of the nitro group, which can influence the reactivity of the aromatic system. Additionally, the presence of the iodine atom can facilitate further chemical transformations, such as nucleophilic substitution. 2-Iodo-3-nitronaphthalene is used in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C10H6INO2
InChI:InChI=1/C10H6INO2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12(13)14/h1-6H
SMILES:c1ccc2cc(c(cc2c1)I)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
