CAS 102154-23-4

1-Iodo-2-nitronaphthalene

Description:

1-Iodo-2-nitronaphthalene is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a naphthalene ring system. It features a naphthalene backbone, which consists of two fused benzene rings, providing a stable aromatic structure. The iodine substituent typically enhances the compound's reactivity, particularly in nucleophilic substitution reactions, while the nitro group is known for its electron-withdrawing properties, influencing the compound's electronic characteristics and reactivity. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Additionally, 1-iodo-2-nitronaphthalene may exhibit distinct spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and analysis in laboratory settings. Safety precautions should be observed when handling this compound due to the potential hazards associated with iodine and nitro groups.

Formula: C₁₀H₆INO₂

InChI: InChI=1S/C10H6INO2/c11-10-8-4-2-1-3-7(8)5-6-9(10)12(13)14/h1-6H

InChI key: InChIKey=GXKBAYRYIIXJGJ-UHFFFAOYSA-N

SMILES: IC=1C2=C(C=CC1N(=O)=O)C=CC=C2

Synonyms:

• NSC 167918
• 1-Iodo-2-nitronaphthalene
• Naphthalene, 1-iodo-2-nitro-