
CAS 102170-56-9
:2-Bromo-6-methyl-4-nitroaniline
Description:
2-Bromo-6-methyl-4-nitroaniline is an organic compound characterized by its aromatic structure, which includes a bromine atom, a methyl group, and a nitro group attached to an aniline backbone. This compound is typically a solid at room temperature and may exhibit a yellow to brown coloration due to the presence of the nitro group. It is known for its potential applications in the synthesis of dyes, pharmaceuticals, and agrochemicals. The presence of the bromine atom enhances its reactivity, making it useful in various substitution reactions. The nitro group contributes to its electron-withdrawing properties, influencing the compound's reactivity and stability. Additionally, 2-Bromo-6-methyl-4-nitroaniline may exhibit moderate solubility in organic solvents, while its solubility in water is generally low. Safety precautions should be observed when handling this compound, as it may pose health risks, including potential toxicity. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C7H7BrN2O2
InChI:InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3
SMILES:Cc1cc(cc(c1N)Br)N(=O)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenamine, 2-bromo-6-methyl-4-nitro-
CAS:Formula:C7H7BrN2O2Purity:95%Color and Shape:SolidMolecular weight:231.04672-Bromo-6-methyl-4-nitroaniline
CAS:2-Bromo-6-methyl-4-nitroanilinePurity:98%Color and Shape:SolidMolecular weight:231.05g/mol2-Bromo-6-methyl-4-nitroaniline
CAS:2-Bromo-6-methyl-4-nitroaniline is a fine chemical that is used in the preparation of other chemicals and as a reagent. It can be used as an intermediate for organic synthesis, such as the conversion of 2-bromoindole to indoxyl, or as a building block for the preparation of more complex compounds. This chemical is also versatile in that it can be used in reactions with different reactants, including amines, carboxylic acids, thiols, and alcohols.Formula:C7H7BrN2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:231.05 g/mol2-Bromo-6-methyl-4-nitroaniline
CAS:Formula:C7H7BrN2O2Purity:95%Color and Shape:SolidMolecular weight:231.049



