
CAS 10218-57-2
:1,1′-(Cyclohexylidenemethylene)bis[4-methoxybenzene]
Description:
1,1′-(Cyclohexylidenemethylene)bis[4-methoxybenzene], with the CAS number 10218-57-2, is an organic compound characterized by its unique structure, which features a cyclohexylidene group linked to two 4-methoxybenzene moieties. This compound typically exhibits properties associated with aromatic compounds, including stability and potential for various chemical reactions due to the presence of methoxy groups that can influence its reactivity and solubility. The methoxy groups enhance its electron-donating characteristics, which can affect its interaction with other chemical species. Additionally, the cyclohexylidene moiety contributes to the compound's steric and electronic properties, potentially impacting its applications in materials science or organic synthesis. The compound may also display interesting thermal and optical properties, making it a candidate for research in fields such as organic electronics or photonics. However, specific physical properties like melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C21H24O2
InChI:InChI=1S/C21H24O2/c1-22-19-12-8-17(9-13-19)21(16-6-4-3-5-7-16)18-10-14-20(23-2)15-11-18/h8-15H,3-7H2,1-2H3
InChI key:InChIKey=DSKROVAOMFMFPL-UHFFFAOYSA-N
SMILES:C(C1=CC=C(OC)C=C1)(C2=CC=C(OC)C=C2)=C3CCCCC3
Synonyms:- 1,1′-(Cyclohexylidenemethylene)bis[4-methoxybenzene]
- Benzene, 1-[cyclohexylidene(4-methoxyphenyl)methyl]-4-methoxy-
- NSC 169635
- Benzene, 1,1′-(cyclohexylidenemethylene)bis[4-methoxy-
- Methane, cyclohexylidenebis(p-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
