CAS 1021859-57-3
:2H-Indazole-3-carboxylic acid, 6-cyano-2-methyl-
Description:
2H-Indazole-3-carboxylic acid, 6-cyano-2-methyl- is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a carboxylic acid functional group and a cyano group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the methyl group at the 2-position of the indazole ring influences its solubility and polarity, making it suitable for various synthetic pathways. The cyano group can participate in nucleophilic addition reactions, while the carboxylic acid can act as a proton donor or acceptor in acid-base reactions. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which can lead to diverse biological activities and functionalities. Its specific properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods or detailed literature reviews.
Formula:C10H7N3O2
InChI:InChI=1S/C10H7N3O2/c1-13-9(10(14)15)7-3-2-6(5-11)4-8(7)12-13/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=CPQVTIDPCAYUOZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=NN1C)C=C(C#N)C=C2
Synonyms:- 2H-Indazole-3-carboxylic acid, 6-cyano-2-methyl-
- 6-Cyano-2-methyl-2H-indazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.