
CAS 1021859-90-4
:Ethyl 8-bromo-3,4-dihydro-4-methyl-2H-1,4-benzoxazine-2-carboxylate
Description:
Ethyl 8-bromo-3,4-dihydro-4-methyl-2H-1,4-benzoxazine-2-carboxylate is a chemical compound characterized by its unique structural features, which include a benzoxazine ring system and a bromine substituent. This compound typically exhibits a molecular structure that combines both aromatic and aliphatic characteristics, contributing to its potential reactivity and stability. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The bromine atom introduces a site for further chemical modification, which can be exploited in synthetic pathways. Additionally, the dihydrobenzoxazine framework may impart interesting biological activities, making it a candidate for pharmacological studies. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound represents a versatile building block in the development of more complex organic molecules.
Formula:C12H14BrNO3
InChI:InChI=1S/C12H14BrNO3/c1-3-16-12(15)10-7-14(2)9-6-4-5-8(13)11(9)17-10/h4-6,10H,3,7H2,1-2H3
InChI key:InChIKey=QMFRYYZALDHBLW-UHFFFAOYSA-N
SMILES:BrC1=C2C(N(C)CC(C(OCC)=O)O2)=CC=C1
Synonyms:- Ethyl 8-bromo-3,4-dihydro-4-methyl-2H-1,4-benzoxazine-2-carboxylate
- Ethyl 8-bromo-4-methyl-3,4-dihydro-2H-benzo[b][1,4]oxazine-2-carboxylate
- 2H-1,4-Benzoxazine-2-carboxylic acid, 8-bromo-3,4-dihydro-4-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1,4-Benzoxazine-2-carboxylic acid, 8-bromo-3,4-dihydro-4-methyl-, ethyl ester
CAS:Formula:C12H14BrNO3Molecular weight:300.1485
